CymitQuimica logo

CAS 1349699-76-8

:

3-Pyrrolidinamine, 1-(cyclobutylmethyl)-, hydrochloride (1:2), (3R)-

Description:
3-Pyrrolidinamine, 1-(cyclobutylmethyl)-, hydrochloride (1:2), (3R)- is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of the cyclobutylmethyl group indicates that it has a cyclobutane moiety attached to the nitrogen of the pyrrolidine, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential applications in pharmaceutical formulations. The (3R)- designation indicates that the compound has a specific stereochemistry, which can significantly influence its biological activity and interaction with receptors. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. Its molecular interactions, stability, and reactivity can be influenced by the presence of the hydrochloride group, making it an interesting subject for further research in drug design and synthesis.
Formula:C9H18N2.2ClH
InChI:InChI=1S/C9H18N2.2ClH/c10-9-4-5-11(7-9)6-8-2-1-3-8;;/h8-9H,1-7,10H2;2*1H/t9-;;/m1../s1
InChI key:InChIKey=HOCSBAUBGQHVCU-KLQYNRQASA-N
SMILES:C(N1C[C@H](N)CC1)C2CCC2.Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.