CAS 1349699-82-6

Urea, N-methyl-N′-(3R)-3-piperidinyl-, hydrochloride (1:1)

Description:

Urea, N-methyl-N′-(3R)-3-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its urea functional group and a piperidine moiety. This compound features a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and is substituted with a methyl group and a urea linkage. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The specific stereochemistry denoted by (3R) suggests that the compound has a defined spatial arrangement, which can influence its biological activity and interactions. Generally, compounds of this nature may exhibit properties such as being a potential drug candidate, with implications in medicinal chemistry, particularly in the development of therapeutics targeting neurological or psychiatric conditions. As with many chemical substances, safety data and handling precautions are essential, given the potential for toxicity or adverse effects associated with improper use.

Formula: C₇H₁₅N₃O·ClH

InChI: InChI=1S/C7H15N3O.ClH/c1-8-7(11)10-6-3-2-4-9-5-6;/h6,9H,2-5H2,1H3,(H2,8,10,11);1H/t6-;/m1./s1

InChI key: InChIKey=ROOILQJCWJMERY-FYZOBXCZSA-N

SMILES: N(C(NC)=O)[C@@H]1CCCNC1.Cl

Synonyms:

• Urea, N-methyl-N′-(3R)-3-piperidinyl-, hydrochloride (1:1)

(R)-3-Methyl-1-(piperidin-3-yl)urea hydrochloride

CAS: 1349699-82-6

Formula: C₇H₁₆ClN₃O

Color and Shape: Liquid

Molecular weight: 193.68

Ref: 10-F069465