CAS 1349699-85-9

1-Propanone, 1-[(3S)-3-amino-1-pyrrolidinyl]-2,2-dimethyl-, hydrochloride (1:1)

Description:

1-Propanone, 1-[(3S)-3-amino-1-pyrrolidinyl]-2,2-dimethyl-, hydrochloride (1:1), with CAS number 1349699-85-9, is a chemical compound characterized by its specific structural features and functional groups. It contains a propanone moiety, which is a ketone, indicating the presence of a carbonyl group (C=O) adjacent to an alkyl group. The compound also includes a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and an amino group, suggesting potential basic properties. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and stability. This compound may exhibit biological activity due to the presence of the amino group and the pyrrolidine structure, which are often associated with pharmacological properties. Its specific stereochemistry, denoted by the (3S) configuration, implies that it has a defined spatial arrangement, which can significantly influence its reactivity and interactions in biological systems. Overall, this compound's characteristics suggest potential applications in medicinal chemistry and pharmacology.

Formula: C₉H₁₈N₂O·ClH

InChI: InChI=1S/C9H18N2O.ClH/c1-9(2,3)8(12)11-5-4-7(10)6-11;/h7H,4-6,10H2,1-3H3;1H/t7-;/m0./s1

InChI key: InChIKey=VWIYDFCZYTWBDH-FJXQXJEOSA-N

SMILES: C(C(C)(C)C)(=O)N1C[C@@H](N)CC1.Cl

Synonyms:

• 1-Propanone, 1-[(3S)-3-amino-1-pyrrolidinyl]-2,2-dimethyl-, hydrochloride (1:1)

(S)-1-(3-Aminopyrrolidin-1-yl)-2,2-dimethylpropan-1-one hydrochloride

CAS: 1349699-85-9

Formula: C₉H₁₉ClN₂O

Molecular weight: 206.71

Ref: 10-F069513