CymitQuimica logo

CAS 1349700-02-2

:

Acetamide, 2-methoxy-N-(3S)-3-piperidinyl-, hydrochloride (1:1)

Description:
Acetamide, 2-methoxy-N-(3S)-3-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from acetic acid. The presence of a methoxy group indicates that it has a methoxy substituent on the acetamide structure, contributing to its solubility and reactivity. The piperidine ring, a six-membered nitrogen-containing heterocycle, imparts basic properties and can influence the compound's pharmacological activity. The "hydrochloride (1:1)" designation indicates that the compound exists as a hydrochloride salt, which typically enhances its stability and solubility in aqueous solutions. This compound may exhibit biological activity, potentially making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific stereochemistry, indicated by the (3S) notation, suggests that it has a defined spatial arrangement, which can significantly affect its interaction with biological targets. Overall, this compound's unique structural features contribute to its potential applications in various chemical and biological contexts.
Formula:C8H16N2O2.ClH
InChI:InChI=1S/C8H16N2O2.ClH/c1-12-6-8(11)10-7-3-2-4-9-5-7;/h7,9H,2-6H2,1H3,(H,10,11);1H/t7-;/m0./s1
InChI key:InChIKey=VASLSTUGMLUIQM-FJXQXJEOSA-N
SMILES:N(C(COC)=O)[C@H]1CCCNC1.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.