CymitQuimica logo

CAS 1349708-88-8

:

4-Bromo-3-chloro-2-methylbenzoic acid

Description:
4-Bromo-3-chloro-2-methylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a benzoic acid core substituted with bromine, chlorine, and a methyl group. The molecular structure features a bromine atom at the para position (4) and a chlorine atom at the meta position (3) relative to the carboxylic acid group, along with a methyl group at the ortho position (2). This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, while its solubility in water is generally limited due to the hydrophobic nature of the aromatic ring. The presence of halogen substituents can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.
Formula:C8H6BrClO2
InChI:InChI=1S/C8H6BrClO2/c1-4-5(8(11)12)2-3-6(9)7(4)10/h2-3H,1H3,(H,11,12)
InChI key:KTMCEFFRDONNOW-UHFFFAOYSA-N
SMILES:CC1=C(C=CC(=C1Cl)Br)C(=O)O
Synonyms:
  • Benzoic acid, 4-bromo-3-chloro-2-methyl-
  • 4-Bromo-3-chloro-2-methylbenzoic acid
Found 4 products.