CAS 1349708-95-7

2′,6′-Difluoro[1,1′-biphenyl]-4-methanol

Description:

2′,6′-Difluoro[1,1′-biphenyl]-4-methanol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 2′ and 6′ positions of one phenyl ring contributes to its unique electronic properties and potential applications in materials science and pharmaceuticals. The hydroxymethyl group (-CH2OH) at the 4-position of the biphenyl framework enhances its solubility in polar solvents and may influence its reactivity and interactions with biological systems. This compound is likely to exhibit interesting chemical behavior due to the electron-withdrawing nature of the fluorine substituents, which can affect the acidity of the hydroxymethyl group and the overall stability of the molecule. Additionally, the structural features suggest potential uses in the development of liquid crystals or as intermediates in organic synthesis. As with many fluorinated compounds, it may also exhibit unique thermal and chemical stability characteristics.

Formula: C₁₃H₁₀F₂O

InChI: InChI=1S/C13H10F2O/c14-11-2-1-3-12(15)13(11)10-6-4-9(8-16)5-7-10/h1-7,16H,8H2

InChI key: InChIKey=OBXBLBYMAXGFNT-UHFFFAOYSA-N

SMILES: FC1=C(C(F)=CC=C1)C2=CC=C(CO)C=C2

Synonyms:

• [1,1′-Biphenyl]-4-methanol, 2′,6′-difluoro-
• 2′,6′-Difluoro[1,1′-biphenyl]-4-methanol