CAS 1349709-00-7
:4-Chloro-β-(2,2,2-trifluoroethyl)benzeneethanamine
Description:
4-Chloro-β-(2,2,2-trifluoroethyl)benzeneethanamine, identified by its CAS number 1349709-00-7, is an organic compound characterized by the presence of a chloro substituent on a benzene ring and an ethylamine side chain. The trifluoroethyl group contributes to its unique properties, including increased lipophilicity and potential biological activity. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity may be influenced by the electron-withdrawing effects of the trifluoroethyl group and the chlorine atom. The presence of these functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the compound's structure may allow for interactions with biological targets, making it of interest in drug discovery. However, specific safety and handling information should be consulted, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact. Overall, 4-Chloro-β-(2,2,2-trifluoroethyl)benzeneethanamine represents a complex molecule with potential utility in various chemical and biological applications.
Formula:C10H11ClF3N
InChI:InChI=1S/C10H11ClF3N/c11-9-3-1-7(2-4-9)8(6-15)5-10(12,13)14/h1-4,8H,5-6,15H2
InChI key:InChIKey=MGTQWRSWRLZKOA-UHFFFAOYSA-N
SMILES:C(CC(F)(F)F)(CN)C1=CC=C(Cl)C=C1
Synonyms:- Benzeneethanamine, 4-chloro-β-(2,2,2-trifluoroethyl)-
- 4-Chloro-β-(2,2,2-trifluoroethyl)benzeneethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
