
CAS 1349709-02-9
:Benzamide, 3-chloro-N-4-piperidinyl-, hydrochloride (1:1)
Description:
Benzamide, 3-chloro-N-4-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its benzamide structure, which features a benzene ring attached to a carbonyl group (amide). The presence of a chlorine atom at the 3-position of the benzene ring and a piperidine moiety at the nitrogen of the amide contributes to its unique properties. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications, particularly in pharmaceutical contexts. The piperidine ring is known for its role in enhancing biological activity, often contributing to the compound's pharmacological effects. As with many amides, it may exhibit moderate stability under standard conditions, but its reactivity can be influenced by the substituents on the benzene ring and the piperidine nitrogen. Safety and handling precautions are essential, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C12H15ClN2O·ClH
InChI:InChI=1S/C12H15ClN2O.ClH/c13-10-3-1-2-9(8-10)12(16)15-11-4-6-14-7-5-11;/h1-3,8,11,14H,4-7H2,(H,15,16);1H
InChI key:InChIKey=SHNIGRQJLMMEAK-UHFFFAOYSA-N
SMILES:C(NC1CCNCC1)(=O)C2=CC(Cl)=CC=C2.Cl
Synonyms:- Benzamide, 3-chloro-N-4-piperidinyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
