CymitQuimica logo

CAS 1349709-09-6

:

4-Bromo-3-cyclopropyl-1-phenyl-1H-pyrazol-5-amine

Description:
4-Bromo-3-cyclopropyl-1-phenyl-1H-pyrazol-5-amine is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a bromine atom, a cyclopropyl group, and a phenyl group. This compound is typically classified as an organic heterocyclic compound due to the presence of nitrogen atoms in the pyrazole ring. The bromine substitution can influence its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The cyclopropyl group may impart specific steric and electronic properties, potentially affecting the compound's biological activity. Additionally, the presence of the phenyl group can enhance lipophilicity, which is often desirable for drug-like properties. The compound's molecular interactions, solubility, and stability are influenced by these substituents, making it a subject of interest in various chemical and biological studies. Overall, 4-Bromo-3-cyclopropyl-1-phenyl-1H-pyrazol-5-amine exemplifies the complexity and diversity of organic compounds used in research and development.
Formula:C12H12BrN3
InChI:InChI=1S/C12H12BrN3/c13-10-11(8-6-7-8)15-16(12(10)14)9-4-2-1-3-5-9/h1-5,8H,6-7,14H2
InChI key:InChIKey=JDTMSEASYQHCTA-UHFFFAOYSA-N
SMILES:BrC=1C(=NN(C1N)C2=CC=CC=C2)C3CC3
Synonyms:
  • 1H-Pyrazol-5-amine, 4-bromo-3-cyclopropyl-1-phenyl-
  • 4-Bromo-3-cyclopropyl-1-phenyl-1H-pyrazol-5-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.