CAS 1349715-48-5

3-(4-Pyrimidinyl)benzenemethanol

Description:

3-(4-Pyrimidinyl)benzenemethanol, identified by its CAS number 1349715-48-5, is an organic compound characterized by the presence of a pyrimidine ring and a benzyl alcohol moiety. This compound features a pyrimidine group substituted at the para position of a benzyl alcohol, which contributes to its potential biological activity and chemical reactivity. The molecular structure suggests that it may exhibit properties such as hydrogen bonding due to the hydroxyl (-OH) group, which can influence its solubility and interaction with other molecules. Additionally, the presence of the pyrimidine ring may impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound's characteristics, including its melting point, boiling point, and solubility, would typically be determined through experimental methods, and its stability can be influenced by environmental factors such as pH and temperature. Overall, 3-(4-Pyrimidinyl)benzenemethanol represents a class of compounds that may have applications in drug development and other chemical research areas.

Formula: C₁₁H₁₀N₂O

InChI: InChI=1S/C11H10N2O/c14-7-9-2-1-3-10(6-9)11-4-5-12-8-13-11/h1-6,8,14H,7H2

InChI key: InChIKey=QBSHNOQPLXWPEF-UHFFFAOYSA-N

SMILES: C(O)C=1C=C(C=CC1)C=2C=CN=CN2

Synonyms:

• 3-(4-Pyrimidinyl)benzenemethanol
• Benzenemethanol, 3-(4-pyrimidinyl)-