CAS 1349715-73-6

1,1-Dimethylethyl 4-[[(5-chloro-2-fluorophenyl)methyl]amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-[[(5-chloro-2-fluorophenyl)methyl]amino]-1-piperidinecarboxylate, identified by its CAS number 1349715-73-6, is a chemical compound characterized by its complex structure, which includes a piperidine ring and various functional groups. This substance features a dimethyl group attached to a tert-butyl group, contributing to its steric bulk. The presence of a chloro and a fluorine atom on the aromatic ring indicates potential reactivity and influences its electronic properties. The amino group linked to the phenyl moiety suggests that it may participate in hydrogen bonding, which can affect its solubility and interaction with biological targets. As a carboxylate ester, it may exhibit stability under certain conditions while being susceptible to hydrolysis. Overall, this compound's unique combination of functional groups and structural features suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies would be necessary to fully understand its properties and potential uses.

Formula: C₁₇H₂₄ClFN₂O₂

InChI: InChI=1S/C17H24ClFN2O2/c1-17(2,3)23-16(22)21-8-6-14(7-9-21)20-11-12-10-13(18)4-5-15(12)19/h4-5,10,14,20H,6-9,11H2,1-3H3

InChI key: InChIKey=YAPOFKJYMFEHJH-UHFFFAOYSA-N

SMILES: C(NC1CCN(C(OC(C)(C)C)=O)CC1)C2=C(F)C=CC(Cl)=C2

Synonyms:

• 1,1-Dimethylethyl 4-[[(5-chloro-2-fluorophenyl)methyl]amino]-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 4-[[(5-chloro-2-fluorophenyl)methyl]amino]-, 1,1-dimethylethyl ester

tert-Butyl 4-(5-chloro-2-fluorobenzylamino)piperidine-1-carboxylate

CAS: 1349715-73-6

Formula: C₁₇H₂₄ClFN₂O₂

Molecular weight: 342.84

Ref: 10-F069763