
CAS 1349715-74-7
:3-(2-Methoxy-5-pyrimidinyl)benzenemethanol
Description:
3-(2-Methoxy-5-pyrimidinyl)benzenemethanol, identified by its CAS number 1349715-74-7, is an organic compound characterized by its complex structure that includes a benzene ring, a pyrimidine moiety, and a hydroxymethyl group. This compound features a methoxy group attached to the pyrimidine, which contributes to its solubility and potential reactivity. The presence of the hydroxymethyl group suggests that it may participate in hydrogen bonding, influencing its physical properties such as melting and boiling points. Additionally, the pyrimidine ring can impart specific biological activities, making this compound of interest in medicinal chemistry. Its molecular interactions may be relevant in the development of pharmaceuticals, particularly in targeting specific biological pathways. The compound's stability, reactivity, and solubility in various solvents can be influenced by the substituents on the aromatic rings, making it a candidate for further research in drug design and synthesis.
Formula:C12H12N2O2
InChI:InChI=1S/C12H12N2O2/c1-16-12-13-6-11(7-14-12)10-4-2-3-9(5-10)8-15/h2-7,15H,8H2,1H3
InChI key:InChIKey=HNXPPCMFLGNAHM-UHFFFAOYSA-N
SMILES:C(O)C=1C=C(C=CC1)C=2C=NC(OC)=NC2
Synonyms:- 3-(2-Methoxy-5-pyrimidinyl)benzenemethanol
- Benzenemethanol, 3-(2-methoxy-5-pyrimidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.