CAS 1349716-39-7

1-[3-(Hydroxymethyl)phenyl]-1H-indole-6-carbonitrile

Description:

1-[3-(Hydroxymethyl)phenyl]-1H-indole-6-carbonitrile is a chemical compound characterized by its complex structure, which includes an indole moiety, a hydroxymethyl group, and a carbonitrile functional group. The presence of the indole ring contributes to its potential biological activity, as indoles are known for their role in various pharmacological properties. The hydroxymethyl group enhances the compound's solubility and may influence its reactivity and interaction with biological targets. The carbonitrile group is notable for its ability to participate in nucleophilic reactions and can serve as a handle for further chemical modifications. This compound may exhibit interesting properties in medicinal chemistry, particularly in the development of new therapeutic agents. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is studied. Overall, 1-[3-(Hydroxymethyl)phenyl]-1H-indole-6-carbonitrile represents a unique structure that could be of interest in various fields, including organic synthesis and drug discovery.

Formula: C₁₆H₁₂N₂O

InChI: InChI=1S/C16H12N2O/c17-10-12-4-5-14-6-7-18(16(14)9-12)15-3-1-2-13(8-15)11-19/h1-9,19H,11H2

InChI key: InChIKey=IEQUHVJPJJHFNW-UHFFFAOYSA-N

SMILES: C(#N)C=1C=C2N(C=CC2=CC1)C3=CC(CO)=CC=C3

Synonyms:

• 1-[3-(Hydroxymethyl)phenyl]-1H-indole-6-carbonitrile
• 1H-Indole-6-carbonitrile, 1-[3-(hydroxymethyl)phenyl]-