CAS 1349716-43-3

3-(6-Methoxy-1H-indol-1-yl)benzenemethanol

Description:

3-(6-Methoxy-1H-indol-1-yl)benzenemethanol, identified by its CAS number 1349716-43-3, is a chemical compound that features a complex structure combining an indole moiety with a benzyl alcohol functional group. The presence of the methoxy group on the indole ring enhances its solubility and may influence its biological activity. This compound is likely to exhibit properties typical of both indole derivatives and phenolic compounds, which can include antioxidant activity, potential neuroprotective effects, and interactions with various biological targets. The molecular structure suggests that it may participate in hydrogen bonding due to the hydroxyl group, which could affect its reactivity and interactions in biological systems. Additionally, the compound's unique arrangement of functional groups may contribute to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or cancer-related pathways. Further studies would be necessary to fully elucidate its properties and potential uses in various fields.

Formula: C₁₆H₁₅NO₂

InChI: InChI=1S/C16H15NO2/c1-19-15-6-5-13-7-8-17(16(13)10-15)14-4-2-3-12(9-14)11-18/h2-10,18H,11H2,1H3

InChI key: InChIKey=QZTLRKYYRUFTME-UHFFFAOYSA-N

SMILES: O(C)C=1C=C2N(C=CC2=CC1)C3=CC(CO)=CC=C3

Synonyms:

• 3-(6-Methoxy-1H-indol-1-yl)benzenemethanol
• Benzenemethanol, 3-(6-methoxy-1H-indol-1-yl)-