CAS 1349716-45-5

3-(5-Chloro-1H-indol-1-yl)benzenemethanol

Description:

3-(5-Chloro-1H-indol-1-yl)benzenemethanol, identified by its CAS number 1349716-45-5, is a chemical compound characterized by its complex structure, which includes an indole moiety and a benzyl alcohol functional group. The presence of the chloro substituent on the indole ring suggests potential reactivity and biological activity, as halogenated indoles are often associated with various pharmacological properties. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic systems, which can influence its solubility and permeability in biological systems. Additionally, the hydroxyl group in the benzyl alcohol portion may participate in hydrogen bonding, affecting its interactions with other molecules. The compound's potential applications could span medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies on its toxicity, stability, and specific reactivity would be necessary to fully understand its characteristics and potential uses in various chemical and biological contexts.

Formula: C₁₅H₁₂ClNO

InChI: InChI=1S/C15H12ClNO/c16-13-4-5-15-12(9-13)6-7-17(15)14-3-1-2-11(8-14)10-18/h1-9,18H,10H2

InChI key: InChIKey=KWNYFTRFHLEDDI-UHFFFAOYSA-N

SMILES: C(O)C=1C=C(N2C=3C(C=C2)=CC(Cl)=CC3)C=CC1

Synonyms:

• Benzenemethanol, 3-(5-chloro-1H-indol-1-yl)-
• 3-(5-Chloro-1H-indol-1-yl)benzenemethanol