
CAS 1349716-48-8
:1-[3-(Hydroxymethyl)phenyl]-1H-indole-5-carboxylic acid
Description:
1-[3-(Hydroxymethyl)phenyl]-1H-indole-5-carboxylic acid, with the CAS number 1349716-48-8, is a chemical compound that features a complex structure combining an indole moiety with a phenyl group substituted by a hydroxymethyl group and a carboxylic acid functional group. This compound is characterized by its potential biological activity, which may include roles in medicinal chemistry or as a biochemical probe. The presence of the hydroxymethyl group suggests it may participate in hydrogen bonding, influencing its solubility and reactivity. The carboxylic acid group contributes to its acidity and can engage in various chemical reactions, including esterification and amidation. Additionally, the indole structure is known for its aromaticity and is often found in many natural products and pharmaceuticals, which may impart unique properties such as fluorescence or interactions with biological targets. Overall, this compound's characteristics make it of interest in research and development within the fields of organic chemistry and pharmacology.
Formula:C16H13NO3
InChI:InChI=1S/C16H13NO3/c18-10-11-2-1-3-14(8-11)17-7-6-12-9-13(16(19)20)4-5-15(12)17/h1-9,18H,10H2,(H,19,20)
InChI key:InChIKey=FLTWCIMWLVUHCA-UHFFFAOYSA-N
SMILES:C(O)C=1C=C(N2C=3C(C=C2)=CC(C(O)=O)=CC3)C=CC1
Synonyms:- 1H-Indole-5-carboxylic acid, 1-[3-(hydroxymethyl)phenyl]-
- 1-[3-(Hydroxymethyl)phenyl]-1H-indole-5-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.