CAS 1349716-50-2

1,1-Dimethylethyl N-[[1-(2-pyridinylcarbonyl)-4-piperidinyl]methyl]carbamate

Description:

1,1-Dimethylethyl N-[[1-(2-pyridinylcarbonyl)-4-piperidinyl]methyl]carbamate, identified by its CAS number 1349716-50-2, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and a piperidine ring. This compound typically exhibits properties associated with both lipophilicity and potential biological activity, making it of interest in pharmaceutical research. The presence of the pyridine moiety suggests that it may engage in hydrogen bonding and π-π interactions, which can influence its solubility and reactivity. Additionally, the dimethyl group contributes to steric hindrance, potentially affecting its interaction with biological targets. The compound may be synthesized through multi-step organic reactions, and its stability can be influenced by environmental factors such as pH and temperature. Overall, this compound's unique structural features may confer specific pharmacological properties, warranting further investigation in medicinal chemistry and drug development contexts.

Formula: C₁₇H₂₅N₃O₃

InChI: InChI=1S/C17H25N3O3/c1-17(2,3)23-16(22)19-12-13-7-10-20(11-8-13)15(21)14-6-4-5-9-18-14/h4-6,9,13H,7-8,10-12H2,1-3H3,(H,19,22)

InChI key: InChIKey=IMLVTLZWURWSDF-UHFFFAOYSA-N

SMILES: C(=O)(N1CCC(CNC(OC(C)(C)C)=O)CC1)C2=CC=CC=N2

Synonyms:

• Carbamic acid, N-[[1-(2-pyridinylcarbonyl)-4-piperidinyl]methyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[[1-(2-pyridinylcarbonyl)-4-piperidinyl]methyl]carbamate

tert-Butyl [(1-picolinoylpiperidin-4-yl)methyl]carbamate

CAS: 1349716-50-2

Formula: C₁₇H₂₅N₃O₃

Molecular weight: 319.405

Ref: 10-F069748