CymitQuimica logo

CAS 1349716-61-5

:

3-Fluoro-4-(3-oxetanyloxy)benzenamine

Description:
3-Fluoro-4-(3-oxetanyloxy)benzenamine, identified by its CAS number 1349716-61-5, is an organic compound characterized by the presence of a fluorine atom and an oxetane ring in its structure. The compound features a benzene ring substituted with an amino group and a fluorine atom at the 3-position, while the 4-position is occupied by an ether linkage to a 3-oxetanyloxy group. This unique combination of functional groups contributes to its potential reactivity and solubility properties. The oxetane moiety may impart strain, influencing the compound's chemical behavior and reactivity. Such compounds are often of interest in medicinal chemistry and materials science due to their potential applications in drug development and polymer synthesis. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, making it a valuable feature in pharmaceutical design. Overall, 3-Fluoro-4-(3-oxetanyloxy)benzenamine represents a complex structure with diverse chemical properties that warrant further investigation for practical applications.
Formula:C9H10FNO2
InChI:InChI=1S/C9H10FNO2/c10-8-3-6(11)1-2-9(8)13-7-4-12-5-7/h1-3,7H,4-5,11H2
InChI key:InChIKey=WFTYADRJDUCEKC-UHFFFAOYSA-N
SMILES:O(C1=C(F)C=C(N)C=C1)C2COC2
Synonyms:
  • Benzenamine, 3-fluoro-4-(3-oxetanyloxy)-
  • 3-Fluoro-4-(3-oxetanyloxy)benzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.