
CAS 1349716-83-1
:3-(2-Naphthalenyl)benzenemethanol
Description:
3-(2-Naphthalenyl)benzenemethanol, identified by its CAS number 1349716-83-1, is an organic compound characterized by a complex structure that includes a naphthalene moiety and a benzyl alcohol functional group. This compound features a naphthalene ring system, which contributes to its aromatic properties and potential for π-π stacking interactions. The presence of the benzenemethanol group indicates that it has a hydroxyl (-OH) functional group, which can participate in hydrogen bonding, influencing its solubility and reactivity. The compound is likely to exhibit moderate to high lipophilicity due to its polycyclic aromatic structure, which may affect its behavior in biological systems and its potential applications in organic synthesis or materials science. Additionally, the structural arrangement suggests that it may have interesting optical properties, making it a candidate for studies in photochemistry or as a potential dye. Overall, the characteristics of 3-(2-Naphthalenyl)benzenemethanol make it a compound of interest in various fields of chemical research.
Formula:C17H14O
InChI:InChI=1S/C17H14O/c18-12-13-4-3-7-15(10-13)17-9-8-14-5-1-2-6-16(14)11-17/h1-11,18H,12H2
InChI key:InChIKey=KNNIMZAVFNSRDC-UHFFFAOYSA-N
SMILES:C(O)C=1C=C(C2=CC3=C(C=C2)C=CC=C3)C=CC1
Synonyms:- 3-(2-Naphthalenyl)benzenemethanol
- Benzenemethanol, 3-(2-naphthalenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.