CAS 1349716-96-6

4-Piperidinamine, N-[(2,4-difluorophenyl)methyl]-, hydrochloride (1:2)

Description:

4-Piperidinamine, N-[(2,4-difluorophenyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a difluorophenyl group, indicating the presence of two fluorine atoms substituted on a phenyl ring at the 2 and 4 positions, which can significantly influence its chemical properties and biological activity. The hydrochloride salt form suggests that the compound is protonated, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the amine functional group indicates potential reactivity, including the ability to form hydrogen bonds, which can affect its interaction with biological targets. Overall, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. However, specific biological activities, toxicity, and detailed physicochemical properties would require empirical investigation and are not provided in the general characterization.

Formula: C₁₂H₁₆F₂N₂·2ClH

InChI: InChI=1S/C12H16F2N2.2ClH/c13-10-2-1-9(12(14)7-10)8-16-11-3-5-15-6-4-11;;/h1-2,7,11,15-16H,3-6,8H2;2*1H

InChI key: InChIKey=DTAQHCPKOCTDBT-UHFFFAOYSA-N

SMILES: C(NC1CCNCC1)C2=C(F)C=C(F)C=C2.Cl

Synonyms:

• 4-Piperidinamine, N-[(2,4-difluorophenyl)methyl]-, hydrochloride (1:2)

N-(2,4-Difluorobenzyl)piperidin-4-amine dihydrochloride

CAS: 1349716-96-6

Formula: C₁₂H₁₈Cl₂F₂N₂

Molecular weight: 299.19

Ref: 10-F069482