CymitQuimica logo

CAS 1349717-03-8

:

3-(1-Methyl-1H-imidazol-5-yl)benzenemethanol

Description:
3-(1-Methyl-1H-imidazol-5-yl)benzenemethanol, identified by its CAS number 1349717-03-8, is an organic compound characterized by the presence of both a benzene ring and an imidazole moiety. The structure features a hydroxymethyl group (-CH2OH) attached to the benzene ring, which contributes to its potential as a versatile building block in organic synthesis. The imidazole ring, which contains nitrogen atoms, imparts unique chemical properties, including the ability to participate in hydrogen bonding and coordination with metal ions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility in polar solvents is likely due to the hydroxymethyl group, while the aromatic nature of the benzene ring may influence its interactions in various chemical environments. Overall, the combination of functional groups in this compound suggests potential applications in pharmaceuticals, agrochemicals, and materials science, warranting further investigation into its reactivity and biological properties.
Formula:C11H12N2O
InChI:InChI=1S/C11H12N2O/c1-13-8-12-6-11(13)10-4-2-3-9(5-10)7-14/h2-6,8,14H,7H2,1H3
InChI key:InChIKey=AOGIIAANWPLDRQ-UHFFFAOYSA-N
SMILES:CN1C(=CN=C1)C2=CC(CO)=CC=C2
Synonyms:
  • Benzenemethanol, 3-(1-methyl-1H-imidazol-5-yl)-
  • 3-(1-Methyl-1H-imidazol-5-yl)benzenemethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.