
CAS 1349717-05-0
:4-Piperidinamine, N-[(2,4,6-trifluorophenyl)methyl]-, hydrochloride (1:2)
Description:
4-Piperidinamine, N-[(2,4,6-trifluorophenyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The presence of the trifluorophenyl group indicates that the compound has significant fluorine substitution, which can enhance its lipophilicity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various applications, particularly in pharmaceuticals. The compound may exhibit properties such as being a potential intermediate in drug synthesis or having specific biological activities, which could include effects on neurotransmitter systems due to the piperidine structure. Its molecular interactions are influenced by the electron-withdrawing trifluoromethyl groups, which can affect its reactivity and binding affinity in biological systems. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.
Formula:C12H15F3N2·2ClH
InChI:InChI=1S/C12H15F3N2.2ClH/c13-8-5-11(14)10(12(15)6-8)7-17-9-1-3-16-4-2-9;;/h5-6,9,16-17H,1-4,7H2;2*1H
InChI key:InChIKey=YWWSXZKTLDIJEN-UHFFFAOYSA-N
SMILES:C(NC1CCNCC1)C2=C(F)C=C(F)C=C2F.Cl
Synonyms:- 4-Piperidinamine, N-[(2,4,6-trifluorophenyl)methyl]-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(2,4,6-Trifluorobenzyl)piperidin-4-amine dihydrochloride
CAS:Formula:C12H17Cl2F3N2Molecular weight:317.18
