CAS 1349717-36-7

3-(6-Amino-2-pyrazinyl)benzenemethanol

Description:

3-(6-Amino-2-pyrazinyl)benzenemethanol is a chemical compound characterized by its unique structure, which includes a pyrazine ring and a benzyl alcohol moiety. The presence of the amino group on the pyrazine ring contributes to its potential as a building block in medicinal chemistry, particularly in the development of pharmaceuticals. This compound may exhibit various biological activities, making it of interest in drug discovery and development. Its solubility and reactivity can be influenced by the functional groups present, such as the hydroxyl (-OH) group from the benzyl alcohol, which can participate in hydrogen bonding and affect its interaction with biological targets. The compound's molecular weight, melting point, and other physical properties would typically be determined through experimental methods. Additionally, safety and handling considerations are essential, as with any chemical substance, to ensure proper laboratory practices. Overall, 3-(6-Amino-2-pyrazinyl)benzenemethanol represents a versatile compound with potential applications in various fields of chemistry and pharmacology.

Formula: C₁₁H₁₁N₃O

InChI: InChI=1S/C11H11N3O/c12-11-6-13-5-10(14-11)9-3-1-2-8(4-9)7-15/h1-6,15H,7H2,(H2,12,14)

InChI key: InChIKey=RWPNAODNSKOMHG-UHFFFAOYSA-N

SMILES: C(O)C=1C=C(C=CC1)C2=NC(N)=CN=C2

Synonyms:

• 3-(6-Amino-2-pyrazinyl)benzenemethanol
• Benzenemethanol, 3-(6-amino-2-pyrazinyl)-