CAS 1349717-39-0

3-(2-Quinolinyl)benzenemethanol

Description:

3-(2-Quinolinyl)benzenemethanol, identified by its CAS number 1349717-39-0, is an organic compound characterized by the presence of a quinoline moiety and a benzyl alcohol functional group. This compound features a quinoline ring system, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring, contributing to its aromatic properties and potential biological activity. The benzyl alcohol part of the molecule provides a hydroxyl (-OH) group, which can participate in hydrogen bonding and may influence the compound's solubility and reactivity. The presence of both aromatic systems suggests that this compound may exhibit interesting electronic properties, making it a candidate for various applications in medicinal chemistry and materials science. Additionally, the structural features may allow for interactions with biological targets, potentially leading to pharmacological effects. However, specific data regarding its physical properties, reactivity, and biological activity would require further investigation through experimental studies.

Formula: C₁₆H₁₃NO

InChI: InChI=1S/C16H13NO/c18-11-12-4-3-6-14(10-12)16-9-8-13-5-1-2-7-15(13)17-16/h1-10,18H,11H2

InChI key: InChIKey=QBGLSCNAKZEZFR-UHFFFAOYSA-N

SMILES: C(O)C=1C=C(C2=NC3=C(C=C2)C=CC=C3)C=CC1

Synonyms:

• 3-(2-Quinolinyl)benzenemethanol
• Benzenemethanol, 3-(2-quinolinyl)-