CAS 1349717-72-1

4-(4-Pyrimidinyl)benzenemethanol

Description:

4-(4-Pyrimidinyl)benzenemethanol, identified by its CAS number 1349717-72-1, is an organic compound characterized by the presence of a pyrimidine ring and a benzyl alcohol moiety. This compound features a pyrimidine group, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3, attached to a benzene ring that is further connected to a hydroxymethyl group (-CH2OH). The presence of both aromatic and heterocyclic structures contributes to its potential biological activity and solubility properties. Typically, compounds of this nature may exhibit various pharmacological effects, making them of interest in medicinal chemistry. The hydroxymethyl group can participate in hydrogen bonding, influencing the compound's reactivity and interactions with biological targets. Additionally, the molecular structure suggests potential for further derivatization, which could enhance its therapeutic profile or alter its physicochemical properties. Overall, 4-(4-Pyrimidinyl)benzenemethanol represents a versatile scaffold for research in drug development and related fields.

Formula: C₁₁H₁₀N₂O

InChI: InChI=1S/C11H10N2O/c14-7-9-1-3-10(4-2-9)11-5-6-12-8-13-11/h1-6,8,14H,7H2

InChI key: InChIKey=WRZIEWSCHQCXIW-UHFFFAOYSA-N

SMILES: C(O)C1=CC=C(C=C1)C=2C=CN=CN2

Synonyms:

• 4-(4-Pyrimidinyl)benzenemethanol
• Benzenemethanol, 4-(4-pyrimidinyl)-