CymitQuimica logo

CAS 1349717-89-0

:

3-(2-Methyl-1H-imidazol-5-yl)benzenemethanol

Description:
3-(2-Methyl-1H-imidazol-5-yl)benzenemethanol, identified by its CAS number 1349717-89-0, is an organic compound characterized by the presence of both an imidazole ring and a benzyl alcohol moiety. The imidazole ring contributes to its potential biological activity, as imidazole derivatives are often found in various pharmaceuticals and biologically active compounds. The benzyl alcohol part of the molecule suggests that it may exhibit properties typical of alcohols, such as solubility in polar solvents and potential reactivity in oxidation or esterification reactions. This compound may also participate in hydrogen bonding due to the hydroxyl (-OH) group, influencing its solubility and interaction with other molecules. Its structural features may allow it to act as a ligand in coordination chemistry or as a precursor in synthetic organic chemistry. Overall, the unique combination of functional groups in this compound suggests a range of potential applications in medicinal chemistry and materials science, although specific properties such as melting point, boiling point, and reactivity would require empirical data for detailed characterization.
Formula:C11H12N2O
InChI:InChI=1S/C11H12N2O/c1-8-12-6-11(13-8)10-4-2-3-9(5-10)7-14/h2-6,14H,7H2,1H3,(H,12,13)
InChI key:InChIKey=BXDOTHWYXOUFHE-UHFFFAOYSA-N
SMILES:C(O)C=1C=C(C=CC1)C=2NC(C)=NC2
Synonyms:
  • 3-(2-Methyl-1H-imidazol-5-yl)benzenemethanol
  • Benzenemethanol, 3-(2-methyl-1H-imidazol-5-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.