CAS 1349717-94-7

3-(2-Methoxy-3-pyridinyl)benzenemethanol

Description:

3-(2-Methoxy-3-pyridinyl)benzenemethanol, identified by its CAS number 1349717-94-7, is an organic compound characterized by its complex structure that includes a benzene ring, a methanol group, and a pyridine moiety. The presence of the methoxy group on the pyridine ring enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. This compound is likely to exhibit polar characteristics due to the hydroxyl (-OH) group, which can participate in hydrogen bonding, affecting its physical properties such as melting and boiling points. Additionally, the pyridine ring contributes to the compound's aromaticity and potential for coordination with metal ions, making it of interest in various chemical and pharmaceutical applications. Its unique structural features may also impart specific biological activities, warranting further investigation in medicinal chemistry. Overall, this compound exemplifies the diverse functionalities that can arise from the combination of aromatic and heterocyclic systems in organic chemistry.

Formula: C₁₃H₁₃NO₂

InChI: InChI=1S/C13H13NO2/c1-16-13-12(6-3-7-14-13)11-5-2-4-10(8-11)9-15/h2-8,15H,9H2,1H3

InChI key: InChIKey=NZPOUBUDNGEMCB-UHFFFAOYSA-N

SMILES: O(C)C1=C(C2=CC(CO)=CC=C2)C=CC=N1

Synonyms:

• Benzenemethanol, 3-(2-methoxy-3-pyridinyl)-
• 3-(2-Methoxy-3-pyridinyl)benzenemethanol