CAS 1349718-35-9

1-Cyclobutyl-1H-pyrazole-4-carboxylic acid

Description:

1-Cyclobutyl-1H-pyrazole-4-carboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclobutyl group and a pyrazole ring. The presence of the carboxylic acid functional group contributes to its acidic properties, making it potentially useful in various chemical reactions and applications. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid moiety. Its molecular structure suggests potential biological activity, which has led to interest in its use in pharmaceuticals or agrochemicals. The pyrazole ring is known for its diverse biological properties, including anti-inflammatory and analgesic effects. Additionally, the cyclobutyl substituent can influence the compound's steric and electronic properties, affecting its reactivity and interactions with other molecules. Overall, 1-Cyclobutyl-1H-pyrazole-4-carboxylic acid represents a class of compounds that may have significant implications in medicinal chemistry and material science.

Formula: C₈H₁₀N₂O₂

InChI: InChI=1S/C8H10N2O2/c11-8(12)6-4-9-10(5-6)7-2-1-3-7/h4-5,7H,1-3H2,(H,11,12)

InChI key: InChIKey=YDPDUABHUDEMLW-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CN(N=C1)C2CCC2

Synonyms:

• 1-Cyclobutyl-1H-pyrazole-4-carboxylic acid
• 1H-Pyrazole-4-carboxylic acid, 1-cyclobutyl-
• 1-Cyclobutylpyrazole-4-carboxylic acid

1-Cyclobutyl-1H-pyrazole-4-carboxylic acid

CAS: 1349718-35-9

1-Cyclobutyl-1H-pyrazole-4-carboxylic acid

Purity: ≥95%

Molecular weight: 166.18g/mol

Ref: 54-OR306188

1-Cyclobutyl-1H-pyrazole-4-carboxylic Acid

CAS: 1349718-35-9

Versatile small molecule scaffold

Formula: C₈H₁₀N₂O₂

Purity: Min. 95%

Molecular weight: 166.18 g/mol

Ref: 3D-ZDC71835

1-Cyclobutyl-1H-pyrazole-4-carboxylic acid

CAS: 1349718-35-9

Color and Shape: Solid, White solid

Molecular weight: 166.17999267578125

Ref: 10-F070546