
CAS 1349718-66-6
:4-(2-Methyl-4-pyridinyl)benzenemethanol
Description:
4-(2-Methyl-4-pyridinyl)benzenemethanol, identified by its CAS number 1349718-66-6, is an organic compound characterized by its structure, which features a benzene ring substituted with a benzenemethanol group and a pyridine moiety. This compound typically exhibits properties associated with both aromatic and alcohol functionalities, including potential solubility in polar solvents due to the hydroxyl group. The presence of the pyridine ring may impart basicity and influence the compound's reactivity, making it of interest in various chemical applications, including medicinal chemistry and material science. Its molecular structure suggests potential interactions with biological targets, which could be explored for pharmacological properties. Additionally, the methyl group on the pyridine ring may affect steric hindrance and electronic properties, influencing the compound's overall behavior in chemical reactions. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its stability and potential toxicity.
Formula:C13H13NO
InChI:InChI=1S/C13H13NO/c1-10-8-13(6-7-14-10)12-4-2-11(9-15)3-5-12/h2-8,15H,9H2,1H3
InChI key:InChIKey=WQNCCPCHARJDDV-UHFFFAOYSA-N
SMILES:CC1=CC(=CC=N1)C2=CC=C(CO)C=C2
Synonyms:- 4-(2-Methyl-4-pyridinyl)benzenemethanol
- Benzenemethanol, 4-(2-methyl-4-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.