CAS 1349718-77-9

4-Bromo-1-methyl-3-(trifluoromethyl)-1H-pyrazol-5-amine

Description:

4-Bromo-1-methyl-3-(trifluoromethyl)-1H-pyrazol-5-amine is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a bromine atom at the 4-position and a trifluoromethyl group at the 3-position significantly influences its chemical properties, including its reactivity and polarity. The amino group at the 5-position contributes to its potential as a building block in pharmaceutical synthesis and agrochemical applications. This compound is likely to exhibit moderate to high solubility in polar solvents due to the presence of the amino group, while the trifluoromethyl group may enhance its lipophilicity. Additionally, the bromine substituent can participate in various chemical reactions, such as nucleophilic substitutions. Overall, 4-Bromo-1-methyl-3-(trifluoromethyl)-1H-pyrazol-5-amine is of interest in medicinal chemistry for its potential biological activities and as a precursor for further chemical modifications.

Formula: C₅H₅BrF₃N₃

InChI: InChI=1S/C5H5BrF3N3/c1-12-4(10)2(6)3(11-12)5(7,8)9/h10H2,1H3

InChI key: InChIKey=QUDKLFPQIWLKEQ-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C(Br)=C(N)N(C)N1

Synonyms:

• 4-Bromo-1-methyl-3-(trifluoromethyl)-1H-pyrazol-5-amine
• 1H-Pyrazol-5-amine, 4-bromo-1-methyl-3-(trifluoromethyl)-