
CAS 1349718-83-7
:3,3,3-Trifluoro-1-propanesulfonyl fluoride
Description:
3,3,3-Trifluoro-1-propanesulfonyl fluoride is a fluorinated sulfonyl fluoride compound characterized by its unique trifluoromethyl group and sulfonyl functional group. This compound typically appears as a colorless to pale yellow liquid and is known for its high reactivity, particularly due to the presence of the sulfonyl fluoride moiety, which can act as a potent electrophile. It is soluble in organic solvents and exhibits stability under normal conditions, although it can hydrolyze in the presence of water, releasing hydrofluoric acid and other byproducts. The trifluoromethyl group contributes to its lipophilicity and can enhance its biological activity, making it of interest in various chemical applications, including as a reagent in organic synthesis and in the development of pharmaceuticals. Safety precautions are essential when handling this compound, as it can be corrosive and toxic, necessitating the use of appropriate personal protective equipment and proper ventilation.
Formula:C3H4F4O2S
InChI:InChI=1S/C3H4F4O2S/c4-3(5,6)1-2-10(7,8)9/h1-2H2
InChI key:InChIKey=RKPHCWRJVYUNST-UHFFFAOYSA-N
SMILES:C(CS(F)(=O)=O)C(F)(F)F
Synonyms:- 3,3,3-Trifluoro-1-propanesulfonyl fluoride
- 1-Propanesulfonyl fluoride, 3,3,3-trifluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.