CAS 1349718-91-7

3-Methoxy-4-(3-oxetanyloxy)benzenemethanamine

Description:

3-Methoxy-4-(3-oxetanyloxy)benzenemethanamine, identified by its CAS number 1349718-91-7, is an organic compound characterized by its complex molecular structure, which includes a methoxy group and an oxetane moiety. This compound features a benzene ring substituted with a methanamine group, contributing to its potential as a building block in medicinal chemistry. The presence of the oxetane ring suggests that it may exhibit unique reactivity and stability properties, making it of interest in synthetic applications. Its methoxy group can enhance solubility and influence the compound's electronic properties, potentially affecting its biological activity. The compound's specific characteristics, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the environment in which it is studied. Overall, 3-Methoxy-4-(3-oxetanyloxy)benzenemethanamine represents a versatile structure that may have implications in drug development and materials science, warranting further investigation into its properties and applications.

Formula: C₁₁H₁₅NO₃

InChI: InChI=1S/C11H15NO3/c1-13-11-4-8(5-12)2-3-10(11)15-9-6-14-7-9/h2-4,9H,5-7,12H2,1H3

InChI key: InChIKey=VTKXTNWARVCNJQ-UHFFFAOYSA-N

SMILES: O(C1=C(OC)C=C(CN)C=C1)C2COC2

Synonyms:

• 3-Methoxy-4-(3-oxetanyloxy)benzenemethanamine
• Benzenemethanamine, 3-methoxy-4-(3-oxetanyloxy)-

[3-Methoxy-4-(oxetan-3-yloxy)phenyl]methanamine

CAS: 1349718-91-7

[3-Methoxy-4-(oxetan-3-yloxy)phenyl]methanamine

Purity: ≥95%

Molecular weight: 209.24g/mol

Ref: 54-OR306073

[3-Methoxy-4-(oxetan-3-yloxy)phenyl]methanamine

CAS: 1349718-91-7

Formula: C₁₁H₁₅NO₃

Molecular weight: 209.245

Ref: 10-F044968