
CAS 1349719-06-7
:3-(2-Methyl-4-pyridinyl)benzenemethanol
Description:
3-(2-Methyl-4-pyridinyl)benzenemethanol, identified by its CAS number 1349719-06-7, is an organic compound characterized by its structure, which features a benzene ring substituted with a benzenemethanol group and a pyridine moiety. The presence of the 2-methyl-4-pyridinyl group introduces both aromaticity and nitrogen functionality, which can influence the compound's reactivity and solubility. This compound is likely to exhibit polar characteristics due to the hydroxyl (-OH) group in the benzenemethanol part, which can engage in hydrogen bonding. Additionally, the methyl and pyridine substituents may impart specific electronic properties, affecting its interaction with biological systems or other chemical entities. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The precise physical and chemical properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods or detailed literature reviews.
Formula:C13H13NO
InChI:InChI=1S/C13H13NO/c1-10-7-13(5-6-14-10)12-4-2-3-11(8-12)9-15/h2-8,15H,9H2,1H3
InChI key:InChIKey=JCUVKYLTSUZUSN-UHFFFAOYSA-N
SMILES:C(O)C=1C=C(C=CC1)C=2C=C(C)N=CC2
Synonyms:- Benzenemethanol, 3-(2-methyl-4-pyridinyl)-
- 3-(2-Methyl-4-pyridinyl)benzenemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.