
CAS 1349719-08-9
:3-(4-Methyl-1-naphthalenyl)benzenemethanol
Description:
3-(4-Methyl-1-naphthalenyl)benzenemethanol, identified by its CAS number 1349719-08-9, is an organic compound characterized by its complex aromatic structure. This substance features a naphthalene ring substituted with a methyl group and is further connected to a benzyl alcohol moiety. The presence of multiple aromatic rings contributes to its stability and potential for π-π stacking interactions, which can influence its solubility and reactivity. The hydroxyl group (-OH) in the benzyl alcohol part of the molecule imparts polar characteristics, making it capable of engaging in hydrogen bonding, which can affect its solubility in various solvents. Additionally, the compound may exhibit interesting photophysical properties due to its extended conjugated system, making it a candidate for applications in organic electronics or as a fluorescent probe. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its behavior in biological systems would require further investigation to understand its potential applications or toxicity.
Formula:C18H16O
InChI:InChI=1S/C18H16O/c1-13-9-10-17(18-8-3-2-7-16(13)18)15-6-4-5-14(11-15)12-19/h2-11,19H,12H2,1H3
InChI key:InChIKey=FNHFLAQXPIIWHA-UHFFFAOYSA-N
SMILES:CC=1C2=C(C(=CC1)C3=CC(CO)=CC=C3)C=CC=C2
Synonyms:- Benzenemethanol, 3-(4-methyl-1-naphthalenyl)-
- 3-(4-Methyl-1-naphthalenyl)benzenemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.