CymitQuimica logo

CAS 1349829-33-9

:

2,3-Dihydrospiro[1H-indene-1,3′-morpholine]

Description:
2,3-Dihydrospiro[1H-indene-1,3′-morpholine] is a chemical compound characterized by its unique spirocyclic structure, which combines an indene moiety with a morpholine ring. This compound typically exhibits a moderate level of polarity due to the presence of the morpholine nitrogen, which can participate in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as spiro compounds often exhibit interesting biological activities. The compound may also display moderate solubility in organic solvents, while its stability can be influenced by environmental factors such as temperature and pH. Additionally, the presence of both aromatic and aliphatic components in its structure may contribute to its reactivity and interaction with other chemical species. Overall, 2,3-Dihydrospiro[1H-indene-1,3′-morpholine] represents a class of compounds that could be of interest for further research in various chemical and biological applications.
Formula:C12H15NO
InChI:InChI=1S/C12H15NO/c1-2-4-11-10(3-1)5-6-12(11)9-14-8-7-13-12/h1-4,13H,5-9H2
InChI key:InChIKey=SSYZYTBCVAXYOV-UHFFFAOYSA-N
SMILES:C12(C=3C(CC1)=CC=CC3)COCCN2
Synonyms:
  • 2,3-Dihydrospiro[indene-1,3′-morpholine]
  • 2,3-Dihydrospiro[1H-indene-1,3′-morpholine]
  • Spiro[1H-indene-1,3′-morpholine], 2,3-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.