CymitQuimica logo

CAS 1349988-73-3

:

5-Methyl-1-(3-pyridinyl)-1H-pyrazole-3-carboxylic acid

Description:
5-Methyl-1-(3-pyridinyl)-1H-pyrazole-3-carboxylic acid is a chemical compound characterized by its pyrazole and pyridine functional groups. It features a methyl group at the 5-position of the pyrazole ring and a carboxylic acid group at the 3-position, contributing to its acidic properties. The presence of the pyridine ring enhances its potential for biological activity, making it of interest in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound may participate in various chemical reactions, including esterification and amidation, due to the reactive carboxylic acid moiety. Overall, 5-Methyl-1-(3-pyridinyl)-1H-pyrazole-3-carboxylic acid is a versatile compound with potential applications in pharmaceuticals and agrochemicals.
Formula:C10H9N3O2
InChI:InChI=1S/C10H9N3O2/c1-7-5-9(10(14)15)12-13(7)8-3-2-4-11-6-8/h2-6H,1H3,(H,14,15)
InChI key:InChIKey=JJCQDUIHVRSJKQ-UHFFFAOYSA-N
SMILES:CC=1N(N=C(C(O)=O)C1)C=2C=CC=NC2
Synonyms:
  • 1H-Pyrazole-3-carboxylic acid, 5-methyl-1-(3-pyridinyl)-
  • 5-Methyl-1-(3-pyridinyl)-1H-pyrazole-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.