
CAS 135-14-8
:Quinolinium, 6,6′-(carbonyldiimino)bis[1-methyl-, bis(methyl sulfate)
Description:
Quinolinium, 6,6′-(carbonyldiimino)bis[1-methyl-, bis(methyl sulfate) is a complex organic compound characterized by its quaternary ammonium structure, which includes a quinolinium moiety and two methyl sulfate groups. This compound is typically used in various chemical applications, including as a reagent in organic synthesis and as a potential antimicrobial agent due to its quaternary ammonium properties. Its structure features a central carbonyl group linked to two imino groups, contributing to its reactivity and solubility in polar solvents. The presence of methyl sulfate groups enhances its ionic character, making it soluble in water and other polar solvents, which is advantageous for its use in biological and chemical processes. Additionally, the compound may exhibit specific biological activities, although its safety and handling require careful consideration due to potential toxicity associated with quaternary ammonium compounds. Overall, this substance is notable for its unique structural features and potential applications in both research and industry.
Formula:C21H20N4O·2CH3O4S
InChI:InChI=1S/C21H19N4O.CH4O4S/c1-24-11-3-5-15-13-17(7-9-19(15)24)22-21(26)23-18-8-10-20-16(14-18)6-4-12-25(20)2;1-5-6(2,3)4/h3-14H,1-2H3,(H-,22,23,26);1H3,(H,2,3,4)/q+1;
InChI key:InChIKey=JFHXCCLRPADCTD-UHFFFAOYSA-N
SMILES:S(OC)(=O)(=O)[O-].C[N+]=1C2=C(C=C(NC(NC3=CC4=C(C=C3)[N+](C)=CC=C4)=O)C=C2)C=CC1
Synonyms:- Acaprin
- Acapron
- Quinolinium, 6,6′-ureylenebis[1-methyl-, bis(methyl sulfate)
- 6,6′-Ureylenebis[1-methylquinolinium methyl sulfate]
- Quinolinium, 6,6′-(carbonyldiimino)bis[1-methyl-, bis(methyl sulfate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Quinuronium Sulfate
CAS:<p>Quinuronium sulfate treats Babesia in calves; doesn't stop carrier state; may lead to hepatic fat degeneration, not GSH depletion.</p>Formula:C22H23N4O5SColor and Shape:SolidMolecular weight:455.51
