CAS 135-58-0
:Mesulfen
Description:
Mesulfen, with the CAS number 135-58-0, is a chemical compound primarily recognized for its application in the field of pharmaceuticals, particularly as an anti-inflammatory agent. It belongs to the class of sulfonamides, which are characterized by the presence of a sulfonamide functional group (-SO2NH2). Mesulfen exhibits properties that allow it to inhibit certain enzymes involved in inflammatory processes, making it useful in treating conditions such as arthritis. The compound is typically administered in specific dosages, and its efficacy is often evaluated through clinical studies. In terms of physical properties, mesulfen is generally a solid at room temperature, with solubility in various organic solvents. Safety data indicates that, like many sulfonamides, it may cause allergic reactions in sensitive individuals. Proper handling and storage conditions are essential to maintain its stability and effectiveness. Overall, mesulfen represents a significant compound in medicinal chemistry, contributing to therapeutic strategies for managing inflammation.
Formula:C14H12S2
InChI:InChI=1S/C14H12S2/c1-9-3-5-11-13(7-9)15-12-6-4-10(2)8-14(12)16-11/h3-8H,1-2H3
InChI key:InChIKey=AHXDSVSZEZHDLV-UHFFFAOYSA-N
SMILES:CC=1C=C2C(SC=3C(S2)=CC=C(C)C3)=CC1
Synonyms:- 2,7-Dimethylthianthrene
- Cutilen
- Cutosolo
- Dimethyldiphenylene Disulphide
- Mesulphen
- Mitabol
- Mitigal
- Neosulfine
- Odylen
- Peligal
- Scabol
- Sudermo
- Thianthol
- Thianthrene, 2,7-dimethyl-
- Thianthrol
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
