CAS 135-70-6
:p-Quaterphenyl
Description:
p-Quaterphenyl, also known as 1,4-bis(phenyl)benzene, is an organic compound characterized by its structure, which consists of four phenyl rings connected in a linear arrangement. This polycyclic aromatic hydrocarbon is a colorless solid at room temperature and is known for its high melting point and thermal stability. p-Quaterphenyl exhibits interesting optical properties, making it useful in various applications, including organic electronics and as a component in liquid crystal displays. It is also studied for its potential in photonic devices due to its ability to emit light when excited. The compound is relatively insoluble in water but can dissolve in organic solvents such as benzene and toluene. Additionally, p-Quaterphenyl is known to undergo photochemical reactions, which can lead to the formation of reactive species. Safety considerations include handling it with care, as it may pose health risks upon inhalation or skin contact. Overall, p-quaterphenyl is a significant compound in materials science and organic chemistry research.
Formula:C24H18
InChI:InChI=1S/C24H18/c1-3-7-19(8-4-1)21-11-15-23(16-12-21)24-17-13-22(14-18-24)20-9-5-2-6-10-20/h1-18H
InChI key:InChIKey=GPRIERYVMZVKTC-UHFFFAOYSA-N
SMILES:C1(=CC=C(C=C1)C2=CC=CC=C2)C3=CC=C(C=C3)C4=CC=CC=C4
Synonyms:- 1,1':4',1'':4'',1'''-Quaterphenyl
- 1,1′-Biphenyl, 4,4′-diphenyl-
- 1,1′:4′,1′′:4′′,1′′′-Quaterphenyl
- 4,4-Diphenylbiphenyl
- Benzerythrene
- Biphenyl, 4,4′-diphenyl-
- NSC 24860
- Para-Quaterphenyl
- Quadriphenyl
- p-Phenylene tetramer
- p-Quaterphenyl
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
p-Quaterphenyl
CAS:Formula:C24H18Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:306.411,1':4',1'':4'',1'''-Quaterphenyl
CAS:Purity:95.0%Color and Shape:Solid, CrystallineMolecular weight:306.4079895019531P-Quaterphenyl
CAS:Controlled ProductApplications P-QUATERPHENYL (cas# 135-70-6) is a useful research chemical.
Formula:C24H18Color and Shape:NeatMolecular weight:306.41,1':4',1'':4'',1'''-Quaterphenyl
CAS:1,1':4',1'':4'',1'''-Quaterphenyl is a quaternary ammonium salt that emits light upon irradiation with UV light. It has a basic structure and the formula weight is approximately 464. The molecule has nitrogen atoms and is a heterocyclic aromatic hydrocarbon. 1,1':4',1'':4'',1'''-Quaterphenyl is made up of four phenyl rings joined in a square planar configuration by two methine bridges. It can be synthesized by reacting trifluoromethanesulfonic acid with biphenyl.Formula:C24H18Purity:Min. 95%Molecular weight:306.4 g/mol





