CAS 135-95-5

(5-amino-2-methoxy-phenyl)methanol

Description:

(5-amino-2-methoxy-phenyl)methanol, with the CAS number 135-95-5, is an organic compound characterized by the presence of an amino group, a methoxy group, and a hydroxymethyl group attached to a phenyl ring. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to its hydroxyl and amino functionalities, which can engage in hydrogen bonding. The methoxy group contributes to its overall hydrophobic character, while the amino group can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, the presence of multiple functional groups suggests that it may undergo various chemical transformations, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₈H₁₁NO₂

InChI: InChI=1/C8H11NO2/c1-11-8-3-2-7(9)4-6(8)5-10/h2-4,10H,5,9H2,1H3

SMILES: COc1ccc(cc1CO)N

Synonyms:

• 5-Amino-2-methoxybenzyl alcohol
• Benzenemethanol, 5-amino-2-methoxy-
• Benzyl alcohol, 5-amino-2-methoxy-

(5-Amino-2-methoxyphenyl)methanol

CAS: 135-95-5

Formula: C₈H₁₁NO₂

Purity: %

Molecular weight: 153.1784

Ref: IN-DA007N37

(5-Amino-2-methoxyphenyl)methanol

CAS: 135-95-5

(5-Amino-2-methoxyphenyl)methanol

Purity: 95+%

Molecular weight: 153.18g/mol

Ref: 54-OR1036203

(5-Amino-2-methoxyphenyl)methanol

CAS: 135-95-5

Purity: 95+%

Molecular weight: 153.1809998

Ref: 10-F640472

(5-Amino-2-methoxyphenyl)methanol

CAS: 135-95-5

Versatile small molecule scaffold

Formula: C₈H₁₁NO₂

Purity: Min. 95%

Molecular weight: 153.18 g/mol

Ref: 3D-AAA13595