CymitQuimica logo

CAS 13501-73-0

:

3,5-Dimethyl-1-hexanol

Description:
3,5-Dimethyl-1-hexanol is an organic compound classified as a primary alcohol, characterized by its six-carbon chain with two methyl groups located at the 3rd and 5th positions. Its molecular formula is C8H18O, indicating the presence of eight carbon atoms, eighteen hydrogen atoms, and one oxygen atom. This compound is typically a colorless liquid at room temperature and possesses a characteristic alcohol odor. It is soluble in organic solvents and exhibits limited solubility in water due to its hydrophobic hydrocarbon chain. The presence of the hydroxyl (-OH) functional group contributes to its reactivity, allowing it to participate in various chemical reactions, such as oxidation and esterification. 3,5-Dimethyl-1-hexanol is utilized in the synthesis of fragrances, flavoring agents, and as a potential intermediate in organic synthesis. Its physical properties, such as boiling point and density, are influenced by the branching of the carbon chain and the presence of the hydroxyl group, which also affects its interactions with other substances. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C8H18O
InChI:InChI=1S/C8H18O/c1-7(2)6-8(3)4-5-9/h7-9H,4-6H2,1-3H3
InChI key:InChIKey=WETBJXIDTZXCBL-UHFFFAOYSA-N
SMILES:C(C(CCO)C)C(C)C
Synonyms:
  • 1-Hexanol, 3,5-dimethyl-
  • 3,5-Dimethyl-1-hexanol
Found 3 products.