CAS 13501-95-6

2,3,4,5-TETRA-O-ACETYL-D-XYLONITRILE

Description:

2,3,4,5-Tetra-O-acetyl-D-xylonitrile is a chemical compound that belongs to the class of nitriles and is derived from D-xylose, a five-carbon sugar. The presence of four acetyl groups indicates that the hydroxyl groups of the sugar have been acetylated, which enhances the compound's stability and solubility in organic solvents. This compound is typically a white to off-white solid and is known for its use in organic synthesis, particularly in carbohydrate chemistry. The acetyl groups can be hydrolyzed under specific conditions, allowing for the regeneration of the original sugar structure. Its nitrile functional group contributes to its reactivity, making it a useful intermediate in various chemical reactions, including nucleophilic additions and cycloadditions. The compound is generally handled with care due to the potential toxicity associated with nitriles. As with many organic compounds, proper storage and handling procedures should be followed to ensure safety and stability.

Formula: C₁₃H₁₇NO₈

InChI: InChI=1/C13H17NO8/c1-7(15)19-6-12(21-9(3)17)13(22-10(4)18)11(5-14)20-8(2)16/h11-13H,6H2,1-4H3

SMILES: CC(=O)OCC(C(C(C#N)OC(=O)C)OC(=O)C)OC(=O)C

Synonyms:

• 2,3,4,5-Tetra-O-acetyl-D-xylononitrile
• 1-Cyanobutane-1,2,3,4-Tetrayl Tetraacetate (Non-Preferred Name)

2,3,4,5-Tetra-O-acetyl-D-xylononitrile

CAS: 13501-95-6

Ref: 7W-GC4802

2,3,4,5-Tetra-O-acetyl-D-xylononitrile

CAS: 13501-95-6

2,3,4,5-Tetra-O-acetyl-D-xylononitrile is a carbohydrate with the chemical formula C10H14O8N2. It is a white crystalline solid that has been custom synthesized with high purity and methylation. This compound is an oligosaccharide with a sugar modification. The glycosylation of this compound is Click modification.

Formula: C₁₃H₁₇NO₈

Purity: Min. 95%

Molecular weight: 315.28 g/mol

Ref: 3D-MT00698