
CAS 135010-56-9
:β-D-Glucopyranoside, 2-(3-hydroxy-4-methoxyphenyl)ethyl O-α-L-arabinopyranosyl-(1→2)-O-6-deoxy-α-L-mannopyranosyl-(1→3)-, 4-[(2E)-3-(4-hydroxy-3-methoxyphenyl)-2-propenoate]
Description:
The chemical substance known as β-D-Glucopyranoside, 2-(3-hydroxy-4-methoxyphenyl)ethyl O-α-L-arabinopyranosyl-(1→2)-O-6-deoxy-α-L-mannopyranosyl-(1→3)-, 4-[(2E)-3-(4-hydroxy-3-methoxyphenyl)-2-propenoate] is a complex glycoside with multiple sugar moieties and phenolic components. It features a glucopyranoside backbone, which is a six-membered cyclic form of glucose, and is substituted with an arabinopyranosyl and a 6-deoxy-mannopyranosyl unit, indicating its structural complexity and potential for various biological interactions. The presence of phenolic groups suggests antioxidant properties, while the methoxy and hydroxy substituents may enhance its reactivity and solubility in organic solvents. This compound may exhibit various biological activities, including anti-inflammatory and antimicrobial effects, due to its diverse functional groups. Its intricate structure makes it a subject of interest in natural product chemistry and pharmacology, particularly in the study of plant-derived compounds and their potential therapeutic applications.
Formula:C36H48O19
InChI:InChI=1S/C36H48O19/c1-16-26(42)28(44)33(55-34-29(45)27(43)21(40)15-50-34)36(51-16)54-32-30(46)35(49-11-10-18-5-8-22(47-2)20(39)12-18)52-24(14-37)31(32)53-25(41)9-6-17-4-7-19(38)23(13-17)48-3/h4-9,12-13,16,21,24,26-40,42-46H,10-11,14-15H2,1-3H3/b9-6+/t16-,21-,24+,26-,27-,28+,29+,30+,31+,32+,33+,34-,35+,36-/m0/s1
InChI key:InChIKey=ZIPURHYPGUGDEP-DQTDZZOCSA-N
SMILES:O([C@H]1[C@H](OC(/C=C/C2=CC(OC)=C(O)C=C2)=O)[C@@H](CO)O[C@@H](OCCC3=CC(O)=C(OC)C=C3)[C@@H]1O)[C@H]4[C@H](O[C@H]5[C@H](O)[C@@H](O)[C@@H](O)CO5)[C@H](O)[C@@H](O)[C@H](C)O4
Synonyms:- Leonoside B
- β-D-Glucopyranoside, 2-(3-hydroxy-4-methoxyphenyl)ethyl O-α-L-arabinopyranosyl-(1→2)-O-6-deoxy-α-L-mannopyranosyl-(1→3)-, 4-[(2E)-3-(4-hydroxy-3-methoxyphenyl)-2-propenoate]
- β-D-Glucopyranoside, 2-(3-hydroxy-4-methoxyphenyl)ethyl O-α-L-arabinopyranosyl-(1→2)-O-6-deoxy-α-L-mannopyranosyl-(1→3)-, 4-[3-(4-hydroxy-3-methoxyphenyl)-2-propenoate], (E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Leonoside B
CAS:Leonoside B is a new phenylpropanoid glycoside from Leonurus glaucescens.Formula:C36H48O19Color and Shape:SolidMolecular weight:784.761
