CAS 135034-10-5
:3-Chloro-6-iodopyridazine
Description:
3-Chloro-6-iodopyridazine is a heterocyclic organic compound characterized by its pyridazine ring, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of chlorine and iodine substituents at the 3 and 6 positions, respectively, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and crystalline form. It is known for its potential applications in medicinal chemistry and as an intermediate in the synthesis of various pharmaceuticals. The halogen substituents can influence the compound's reactivity, solubility, and biological activity, making it of interest in drug development. Additionally, 3-chloro-6-iodopyridazine may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, due to the presence of the halogens. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, this compound represents a valuable structure in the field of organic synthesis and medicinal chemistry.
Formula:C4H2ClIN2
InChI:InChI=1/C4H2ClIN2/c5-3-1-2-4(6)8-7-3/h1-2H
SMILES:c1cc(I)nnc1Cl
Synonyms:- Pyridazine, 3-chloro-6-iodo-
- T6Nnj Ci Fg
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Chloro-6-iodopyridazine, 95%
CAS:Reacant in Suzuki-Miyaura coupling reaction. Reactant in the synthesis of 6-Chloropyridazine-3-carbonitrile. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The originalFormula:C4H2ClIN2Purity:95%Molecular weight:240.433-Chloro-6-iodopyridazine
CAS:Formula:C4H2ClIN2Purity:97%Color and Shape:SolidMolecular weight:240.42963-Chloro-6-iodopyridazine
CAS:3-Chloro-6-iodopyridazineFormula:C4H2ClIN2Purity:99%Color and Shape: off-white to faint yellow solidMolecular weight:240.43g/mol3-Chloro-6-iodopyridazine
CAS:Formula:C4H2ClIN2Purity:97%Color and Shape:SolidMolecular weight:240.43



