CAS 1350443-32-1

4-Bromo-5-(3-chlorophenyl)-1H-pyrazole-3-carboxylic acid

Description:

4-Bromo-5-(3-chlorophenyl)-1H-pyrazole-3-carboxylic acid is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a bromine atom at the 4-position and a 3-chlorophenyl group at the 5-position contributes to its unique reactivity and potential biological activity. The carboxylic acid functional group at the 3-position enhances its solubility in polar solvents and can participate in various chemical reactions, such as esterification or amidation. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the presence of halogen substituents can influence the compound's lipophilicity and interaction with biological targets. As with many pyrazole derivatives, it may also exhibit anti-inflammatory or analgesic properties, although specific biological activities would require further investigation. Safety and handling precautions should be observed due to the presence of halogens and the potential for biological activity.

Formula: C₁₀H₆BrClN₂O₂

InChI: InChI=1S/C10H6BrClN2O2/c11-7-8(13-14-9(7)10(15)16)5-2-1-3-6(12)4-5/h1-4H,(H,13,14)(H,15,16)

InChI key: InChIKey=GFAYBEBCABHUAP-UHFFFAOYSA-N

SMILES: BrC1=C(NN=C1C(O)=O)C2=CC(Cl)=CC=C2

Synonyms:

• 4-Bromo-5-(3-chlorophenyl)-1H-pyrazole-3-carboxylic acid
• 1H-Pyrazole-3-carboxylic acid, 4-bromo-5-(3-chlorophenyl)-