CAS 1350475-40-9

9-(1,1-Dimethylethyl) 2-ethyl 1-oxo-6-oxa-9-azaspiro[4.5]decane-2,9-dicarboxylate

Description:

9-(1,1-Dimethylethyl) 2-ethyl 1-oxo-6-oxa-9-azaspiro[4.5]decane-2,9-dicarboxylate, with the CAS number 1350475-40-9, is a complex organic compound characterized by its unique spirocyclic structure, which includes both ester and amide functional groups. This compound features a bicyclic framework that incorporates a nitrogen atom, contributing to its azaspiro designation. The presence of the 1,1-dimethylethyl group and the ethyl substituent enhances its steric bulk, potentially influencing its reactivity and solubility properties. The dicarboxylate moiety suggests that it may participate in various chemical reactions, including esterification and amidation. Its oxo group indicates the presence of a carbonyl functionality, which can be involved in further chemical transformations. The compound's structural complexity may also impart interesting biological activity, making it a candidate for pharmaceutical research. Overall, this substance exemplifies the diversity of organic compounds and their potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₆H₂₅NO₆

InChI: InChI=1S/C16H25NO6/c1-5-21-13(19)11-6-7-16(12(11)18)10-17(8-9-22-16)14(20)23-15(2,3)4/h11H,5-10H2,1-4H3

InChI key: InChIKey=ZGPYJACUYUETHH-UHFFFAOYSA-N

SMILES: O=C1C2(CN(C(OC(C)(C)C)=O)CCO2)CCC1C(OCC)=O

Synonyms:

• 9-(1,1-Dimethylethyl) 2-ethyl 1-oxo-6-oxa-9-azaspiro[4.5]decane-2,9-dicarboxylate
• 6-Oxa-9-azaspiro[4.5]decane-2,9-dicarboxylic acid, 1-oxo-, 9-(1,1-dimethylethyl) 2-ethyl ester

9-tert-Butyl 2-ethyl 1-oxo-6-oxa-9-azaspiro[4.5]decane-2,9-dicarboxylate

CAS: 1350475-40-9

Formula: C₁₆H₂₅NO₆

Purity: 95%

Molecular weight: 327.3728

Ref: IN-DA00HTUW

9-(Tert-butyl) 2-ethyl 1-oxo-6-oxa-9-azaspiro[4.5]Decane-2,9-dicarboxylate

CAS: 1350475-40-9

Purity: 98%

Molecular weight: 327.3770142

Ref: 10-F768696