CAS 13505-34-5
:2,6-Heptanedione
Description:
2,6-Heptanedione, with the CAS number 13505-34-5, is a diketone characterized by its two carbonyl (C=O) functional groups located at the second and sixth positions of a seven-carbon chain. This compound is a colorless to pale yellow liquid with a distinctive sweet, buttery odor, often associated with diketones. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic hydrocarbon chain. 2,6-Heptanedione is known for its use as a flavoring agent and in the synthesis of various organic compounds. Its chemical structure allows it to participate in various reactions, including condensation and oxidation, making it a versatile intermediate in organic synthesis. Additionally, it exhibits properties typical of diketones, such as reactivity towards nucleophiles and the ability to form enolates. Safety data indicates that it should be handled with care, as it may cause irritation to the skin and eyes.
Formula:C7H12O2
InChI:InChI=1S/C7H12O2/c1-6(8)4-3-5-7(2)9/h3-5H2,1-2H3
InChI key:InChIKey=VAIFYHGFLAPCON-UHFFFAOYSA-N
SMILES:C(CC(C)=O)CC(C)=O
Synonyms:- 2,6-Heptanedione
- Nsc 315627
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
