CymitQuimica logo

CAS 13505-41-4

:

4,4,4-TRICHLORO-3-HYDROXY-1-PHENYL-BUTAN-1-ONE

Description:
4,4,4-Trichloro-3-hydroxy-1-phenyl-butan-1-one, with the CAS number 13505-41-4, is a synthetic organic compound characterized by its complex structure, which includes a phenyl group, a ketone functional group, and multiple chlorine substituents. This compound typically appears as a solid or crystalline substance and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of three chlorine atoms contributes to its reactivity and may influence its biological activity, making it a subject of interest in medicinal chemistry. The hydroxyl group enhances its solubility in polar solvents, while the ketone functionality can participate in various chemical reactions, such as nucleophilic additions. Safety data indicates that, like many chlorinated compounds, it may pose environmental and health risks, necessitating careful handling and disposal. Overall, 4,4,4-trichloro-3-hydroxy-1-phenyl-butan-1-one is a compound of significant interest due to its unique chemical properties and potential applications.
Formula:C10H9Cl3O2
InChI:InChI=1/C10H9Cl3O2/c11-10(12,13)9(15)6-8(14)7-4-2-1-3-5-7/h1-5,9,15H,6H2
SMILES:c1ccc(cc1)C(=O)CC(C(Cl)(Cl)Cl)O
Synonyms:
  • 1-Butanone, 4,4,4-Trichloro-3-Hydroxy-1-Phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.