CAS 1350514-68-9: MK 5172
Description:MK-5172, also known as Grazoprevir, is a potent and selective inhibitor of the hepatitis C virus (HCV) NS3/4A protease, which plays a crucial role in the viral replication process. This compound is characterized by its ability to effectively inhibit the replication of various HCV genotypes, making it a valuable component in antiviral therapy. MK-5172 is typically administered in combination with other antiviral agents to enhance its efficacy and reduce the potential for resistance. The substance is known for its favorable pharmacokinetic profile, including good oral bioavailability and a relatively long half-life, which supports once-daily dosing. Additionally, it has been evaluated in clinical trials for its safety and tolerability, showing a manageable side effect profile. As a small molecule drug, MK-5172 is synthesized through complex organic chemistry processes, and its development represents a significant advancement in the treatment of chronic hepatitis C infection.
Formula:C38H50N6O9S
InChI:InChI=1S/C38H50N6O9S/c1-6-22-19-38(22,35(47)43-54(49,50)25-13-14-25)42-32(45)29-18-24-20-44(29)34(46)31(37(2,3)4)41-36(48)53-30-16-21(30)10-8-7-9-11-27-33(52-24)40-28-17-23(51-5)12-15-26(28)39-27/h6,12,15,17,21-22,24-25,29-31H,1,7-11,13-14,16,18-20H2,2-5H3,(H,41,48)(H,42,45)(H,43,47)/t21-,22-,24-,29+,30-,31-,38-/m1/s1
InChI key:InChIKey=OBMNJSNZOWALQB-NCQNOWPTSA-N
SMILES:O=C1OC2CC2CCCCCC=3N=C4C=CC(OC)=CC4=NC3OC5CN(C(=O)C(N1)C(C)(C)C)C(C(=O)NC6(C(=O)NS(=O)(=O)C7CC7)CC6C=C)C5
- Synonyms:
- Grazoprevir
- MK 5172
- Cyclopropanecarboxamide, N-[[[(1R,2R)-2-[5-(3-hydroxy-6-methoxy-2-quinoxalinyl)pentyl]cyclopropyl]oxy]carbonyl]-3-methyl-L-valyl-(4R)-4-hydroxy-L-prolyl-1-amino-N-(cyclopropylsulfonyl)-2-ethenyl-, cyclic (1→2)-ether, (1R,2S)-
