CymitQuimica logo

CAS 135053-20-2

:

(1R,2R)-1-aminoindane-2-carboxylic acid

Description:
(1R,2R)-1-aminoindane-2-carboxylic acid, with the CAS number 135053-20-2, is a chiral amino acid derivative characterized by its indane structure, which consists of a fused benzene and cyclopentane ring. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to the indane framework, contributing to its classification as an amino acid. The specific stereochemistry indicated by the (1R,2R) designation suggests that it has two chiral centers, which can influence its biological activity and interactions. This compound is of interest in medicinal chemistry and pharmacology due to its potential applications in drug development, particularly in the design of compounds that target specific biological pathways. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature, making it important to consider these factors in experimental settings. Overall, (1R,2R)-1-aminoindane-2-carboxylic acid represents a unique structure with potential implications in various chemical and biological contexts.
Formula:C10H11NO2
InChI:InChI=1/C10H11NO2/c11-9-7-4-2-1-3-6(7)5-8(9)10(12)13/h1-4,8-9H,5,11H2,(H,12,13)/t8-,9+/m1/s1
InChI key:DNDUYUYIRYKACW-BDAKNGLRSA-N
SMILES:C1[C@H]([C@H](C2=CC=CC=C21)N)C(=O)O
Synonyms:
  • 1H-indene-2-carboxylic acid, 1-amino-2,3-dihydro-, (1R,2R)-
  • (1R,2R)-1-Aminoindane-2-carboxylic acid
Found 1 products.